نمایش نتایج جستجو برای
کلمات کلیدی: UV spectrum
موارد یافت شده: 2
1 - Influence of fluorine substitution on the molecular structure, vibrational assignment, Cu–O bond strength and biological properties by comparing copper (II) trifluorobenzoylacetonate and benzoylacetonate complexes (چکیده)2 - Syntheses and Characterization of Two Novel Inorganic-Organic Hybrid Materials Based on Polyoxotungstoborate: [L-C2H5NO2-H]3[H2BW12O40].5H2O and [CH4N2O-H]2[H3BW12O40].5H2O (C2H5NO2 = Glycine; CH4N2O = Urea), (چکیده)
